C23H36O2 — CID 54312651
[4-[(4R)-4,8-dimethylnon-7-enyl]-2,6-diethylphenyl] acetate (PubChem CID 54312651) has the molecular formula C23H36O2 and a molecular weight of 344.54 g/mol. Its IUPAC name is [4-[(4R)-4,8-dimethylnon-7-enyl]-2,6-diethylphenyl] acetate.
| Compound Name | [4-[(4R)-4,8-dimethylnon-7-enyl]-2,6-diethylphenyl] acetate |
|---|---|
| PubChem CID | 54312651 |
| Molecular Formula | C23H36O2 |
| Molecular Weight | 344.54 g/mol |
| Exact Mass | 344.27 |
| IUPAC Name | [4-[(4R)-4,8-dimethylnon-7-enyl]-2,6-diethylphenyl] acetate |
| SMILES | CCc1cc(CCC[C@@H](C)CCC=C(C)C)cc(CC)c1OC(C)=O |
| InChI | InChI=1S/C23H36O2/c1-7-21-15-20(16-22(8-2)23(21)25-19(6)24)14-10-13-18(5)12-9-11-17(3)4/h11,15-16,18H,7-10,12-14H2,1-6H3/t18-/m0/s1 |
| InChIKey | SLZJCADSEOXSCX-SFHVURJKSA-N |
| XLogP | 6.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.54 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|