C21H32O3 — CID 57062358
[4-(3,7-dimethyloct-6-enoxy)-2,3,6-trimethylphenyl] acetate (PubChem CID 57062358) has the molecular formula C21H32O3 and a molecular weight of 332.48 g/mol. Its IUPAC name is [4-(3,7-dimethyloct-6-enoxy)-2,3,6-trimethylphenyl] acetate.
| Compound Name | [4-(3,7-dimethyloct-6-enoxy)-2,3,6-trimethylphenyl] acetate |
|---|---|
| PubChem CID | 57062358 |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | [4-(3,7-dimethyloct-6-enoxy)-2,3,6-trimethylphenyl] acetate |
| SMILES | CC(=O)Oc1c(C)cc(OCCC(C)CCC=C(C)C)c(C)c1C |
| InChI | InChI=1S/C21H32O3/c1-14(2)9-8-10-15(3)11-12-23-20-13-16(4)21(24-19(7)22)18(6)17(20)5/h9,13,15H,8,10-12H2,1-7H3 |
| InChIKey | BCLZYYYKFPFOJC-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|