C48H75N3O6 — CID 102146750
N-[6-(propanoylamino)-4-[[3,4,5-tris[(3R)-3,7-dimethyloct-6-enoxy]phenyl]methoxy]-2-pyridinyl]propanamide (PubChem CID 102146750) has the molecular formula C48H75N3O6 and a molecular weight of 790.14 g/mol. Its IUPAC name is N-[6-(propanoylamino)-4-[[3,4,5-tris[(3R)-3,7-dimethyloct-6-enoxy]phenyl]methoxy]-2-pyridinyl]propanamide.
| Compound Name | N-[6-(propanoylamino)-4-[[3,4,5-tris[(3R)-3,7-dimethyloct-6-enoxy]phenyl]methoxy]-2-pyridinyl]propanamide |
|---|---|
| PubChem CID | 102146750 |
| Molecular Formula | C48H75N3O6 |
| Molecular Weight | 790.14 g/mol |
| Exact Mass | 789.57 |
| IUPAC Name | N-[6-(propanoylamino)-4-[[3,4,5-tris[(3R)-3,7-dimethyloct-6-enoxy]phenyl]methoxy]-2-pyridinyl]propanamide |
| SMILES | CCC(=O)Nc1cc(OCc2cc(OCC[C@H](C)CCC=C(C)C)c(OCC[C@H](C)CCC=C(C)C)c(OCC[C@H](C)CCC=C(C)C)c2)cc(NC(=O)CC)n1 |
| InChI | InChI=1S/C48H75N3O6/c1-12-46(52)50-44-31-41(32-45(49-44)51-47(53)13-2)57-33-40-29-42(54-26-23-37(9)20-14-17-34(3)4)48(56-28-25-39(11)22-16-19-36(7)8)43(30-40)55-27-24-38(10)21-15-18-35(5)6/h17-19,29-32,37-39H,12-16,20-28,33H2,1-11H3,(H2,49,50,51,52,53)/t37-,38-,39-/m1/s1 |
| InChIKey | KNHKDRGBGYEZGZ-CCUSMBMVSA-N |
| XLogP | 12.81 |
| TPSA | 108.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.14 |
| LogP ≤ 5 | 12.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|