C117H201N3O12 — CID 74975190
N-[3,5-bis[[3,4,5-tris(3,7-dimethyloctoxy)benzoyl]amino]phenyl]-3,4,5-tris(3,7-dimethyloctoxy)benzamide (PubChem CID 74975190) has the molecular formula C117H201N3O12 and a molecular weight of 1841.90 g/mol. Its IUPAC name is N-[3,5-bis[[3,4,5-tris(3,7-dimethyloctoxy)benzoyl]amino]phenyl]-3,4,5-tris(3,7-dimethyloctoxy)benzamide.
| Compound Name | N-[3,5-bis[[3,4,5-tris(3,7-dimethyloctoxy)benzoyl]amino]phenyl]-3,4,5-tris(3,7-dimethyloctoxy)benzamide |
|---|---|
| PubChem CID | 74975190 |
| Molecular Formula | C117H201N3O12 |
| Molecular Weight | 1841.90 g/mol |
| Exact Mass | 1840.52 |
| IUPAC Name | N-[3,5-bis[[3,4,5-tris(3,7-dimethyloctoxy)benzoyl]amino]phenyl]-3,4,5-tris(3,7-dimethyloctoxy)benzamide |
| SMILES | CC(C)CCCC(C)CCOc1cc(C(=O)Nc2cc(NC(=O)c3cc(OCCC(C)CCCC(C)C)c(OCCC(C)CCCC(C)C)c(OCCC(C)CCCC(C)C)c3)cc(NC(=O)c3cc(OCCC(C)CCCC(C)C)c(OCCC(C)CCCC(C)C)c(OCCC(C)CCCC(C)C)c3)c2)cc(OCCC(C)CCCC(C)C)c1OCCC(C)CCCC(C)C |
| InChI | InChI=1S/C117H201N3O12/c1-82(2)37-28-46-91(19)55-64-124-106-73-100(74-107(125-65-56-92(20)47-29-38-83(3)4)112(106)130-70-61-97(25)52-34-43-88(13)14)115(121)118-103-79-104(119-116(122)101-75-108(126-66-57-93(21)48-30-39-84(5)6)113(131-71-62-98(26)53-35-44-89(15)16)109(76-101)127-67-58-94(22)49-31-40-85(7)8)81-105(80-103)120-117(123)102-77-110(128-68-59-95(23)50-32-41-86(9)10)114(132-72-63-99(27)54-36-45-90(17)18)111(78-102)129-69-60-96(24)51-33-42-87(11)12/h73-99H,28-72H2,1-27H3,(H,118,121)(H,119,122)(H,120,123) |
| InChIKey | FFZHMVRFMFNBCM-UHFFFAOYSA-N |
| XLogP | 34.53 |
| TPSA | 170.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 78 |
| Heavy Atoms | 132 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1841.90 |
| LogP ≤ 5 | 34.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |