C43H69N3O8 — CID 87306703
3,4,5-tris[(3R)-3,7-dimethyloctoxy]-N-(3,5-dinitrophenyl)benzamide (PubChem CID 87306703) has the molecular formula C43H69N3O8 and a molecular weight of 756.04 g/mol. Its IUPAC name is 3,4,5-tris[(3R)-3,7-dimethyloctoxy]-N-(3,5-dinitrophenyl)benzamide.
| Compound Name | 3,4,5-tris[(3R)-3,7-dimethyloctoxy]-N-(3,5-dinitrophenyl)benzamide |
|---|---|
| PubChem CID | 87306703 |
| Molecular Formula | C43H69N3O8 |
| Molecular Weight | 756.04 g/mol |
| Exact Mass | 755.51 |
| IUPAC Name | 3,4,5-tris[(3R)-3,7-dimethyloctoxy]-N-(3,5-dinitrophenyl)benzamide |
| SMILES | CC(C)CCC[C@@H](C)CCOc1cc(C(=O)Nc2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)cc(OCC[C@H](C)CCCC(C)C)c1OCC[C@H](C)CCCC(C)C |
| InChI | InChI=1S/C43H69N3O8/c1-30(2)13-10-16-33(7)19-22-52-40-25-36(43(47)44-37-27-38(45(48)49)29-39(28-37)46(50)51)26-41(53-23-20-34(8)17-11-14-31(3)4)42(40)54-24-21-35(9)18-12-15-32(5)6/h25-35H,10-24H2,1-9H3,(H,44,47)/t33-,34-,35-/m1/s1 |
| InChIKey | YSSSYXFPPSCXRO-YAFWASLJSA-N |
| XLogP | 12.45 |
| TPSA | 143.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.04 |
| LogP ≤ 5 | 12.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|