C22H30N2O4S — CID 40558616
[(3R)-3,7-dimethyloct-6-enyl] 4-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-4-oxobutanoate (PubChem CID 40558616) has the molecular formula C22H30N2O4S and a molecular weight of 418.56 g/mol. Its IUPAC name is [(3R)-3,7-dimethyloct-6-enyl] 4-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-4-oxobutanoate.
| Compound Name | [(3R)-3,7-dimethyloct-6-enyl] 4-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 40558616 |
| Molecular Formula | C22H30N2O4S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | [(3R)-3,7-dimethyloct-6-enyl] 4-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-4-oxobutanoate |
| SMILES | COc1ccc2nc(NC(=O)CCC(=O)OCC[C@H](C)CCC=C(C)C)sc2c1 |
| InChI | InChI=1S/C22H30N2O4S/c1-15(2)6-5-7-16(3)12-13-28-21(26)11-10-20(25)24-22-23-18-9-8-17(27-4)14-19(18)29-22/h6,8-9,14,16H,5,7,10-13H2,1-4H3,(H,23,24,25)/t16-/m1/s1 |
| InChIKey | GGWZGMZMSJAUPC-MRXNPFEDSA-N |
| XLogP | 5.34 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|