C15H15N3O2S — CID 3237471
N-(6-methoxy-1,3-benzothiazol-2-yl)-3-pyrrol-1-ylpropanamide (PubChem CID 3237471) has the molecular formula C15H15N3O2S and a molecular weight of 301.37 g/mol. Its IUPAC name is N-(6-methoxy-1,3-benzothiazol-2-yl)-3-pyrrol-1-ylpropanamide.
| Compound Name | N-(6-methoxy-1,3-benzothiazol-2-yl)-3-pyrrol-1-ylpropanamide |
|---|---|
| PubChem CID | 3237471 |
| Molecular Formula | C15H15N3O2S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | N-(6-methoxy-1,3-benzothiazol-2-yl)-3-pyrrol-1-ylpropanamide |
| SMILES | COc1ccc2nc(NC(=O)CCn3cccc3)sc2c1 |
| InChI | InChI=1S/C15H15N3O2S/c1-20-11-4-5-12-13(10-11)21-15(16-12)17-14(19)6-9-18-7-2-3-8-18/h2-5,7-8,10H,6,9H2,1H3,(H,16,17,19) |
| InChIKey | YBZXUTANVCVFPJ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |