C13H14N2O4S2 — CID 11953106
3-[2-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-2-oxoethyl]sulfanylpropanoic acid (PubChem CID 11953106) has the molecular formula C13H14N2O4S2 and a molecular weight of 326.40 g/mol. Its IUPAC name is 3-[2-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-2-oxoethyl]sulfanylpropanoic acid.
| Compound Name | 3-[2-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-2-oxoethyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 11953106 |
| Molecular Formula | C13H14N2O4S2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | 3-[2-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-2-oxoethyl]sulfanylpropanoic acid |
| SMILES | COc1ccc2nc(NC(=O)CSCCC(=O)O)sc2c1 |
| InChI | InChI=1S/C13H14N2O4S2/c1-19-8-2-3-9-10(6-8)21-13(14-9)15-11(16)7-20-5-4-12(17)18/h2-3,6H,4-5,7H2,1H3,(H,17,18)(H,14,15,16) |
| InChIKey | LTIGEXLTHMEICO-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|