C23H36O2S — CID 57181629
[2-tert-butyl-4-(3,7-dimethyloct-6-enylsulfanyl)phenyl] propanoate (PubChem CID 57181629) has the molecular formula C23H36O2S and a molecular weight of 376.61 g/mol. Its IUPAC name is [2-tert-butyl-4-(3,7-dimethyloct-6-enylsulfanyl)phenyl] propanoate.
| Compound Name | [2-tert-butyl-4-(3,7-dimethyloct-6-enylsulfanyl)phenyl] propanoate |
|---|---|
| PubChem CID | 57181629 |
| Molecular Formula | C23H36O2S |
| Molecular Weight | 376.61 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | [2-tert-butyl-4-(3,7-dimethyloct-6-enylsulfanyl)phenyl] propanoate |
| SMILES | CCC(=O)Oc1ccc(SCCC(C)CCC=C(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C23H36O2S/c1-8-22(24)25-21-13-12-19(16-20(21)23(5,6)7)26-15-14-18(4)11-9-10-17(2)3/h10,12-13,16,18H,8-9,11,14-15H2,1-7H3 |
| InChIKey | QYAQNZHAWQUOPK-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.61 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|