C24H34 — CID 123605805
1-(3,7-dimethyloct-6-enyl)-4-(4-ethylcyclohexa-1,3-dien-1-yl)benzene (PubChem CID 123605805) has the molecular formula C24H34 and a molecular weight of 322.54 g/mol. Its IUPAC name is 1-(3,7-dimethyloct-6-enyl)-4-(4-ethylcyclohexa-1,3-dien-1-yl)benzene.
| Compound Name | 1-(3,7-dimethyloct-6-enyl)-4-(4-ethylcyclohexa-1,3-dien-1-yl)benzene |
|---|---|
| PubChem CID | 123605805 |
| Molecular Formula | C24H34 |
| Molecular Weight | 322.54 g/mol |
| Exact Mass | 322.27 |
| IUPAC Name | 1-(3,7-dimethyloct-6-enyl)-4-(4-ethylcyclohexa-1,3-dien-1-yl)benzene |
| SMILES | CCC1=CC=C(c2ccc(CCC(C)CCC=C(C)C)cc2)CC1 |
| InChI | InChI=1S/C24H34/c1-5-21-11-15-23(16-12-21)24-17-13-22(14-18-24)10-9-20(4)8-6-7-19(2)3/h7,11,13-15,17-18,20H,5-6,8-10,12,16H2,1-4H3 |
| InChIKey | WXCILKITDICABK-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.54 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|