C32H46O2 — CID 134297771
2-[(E)-4,8-dimethylnon-3-enyl]-2-methyl-6-(4-methylpentyl)-1H-anthracene-9,10-diol (PubChem CID 134297771) has the molecular formula C32H46O2 and a molecular weight of 462.72 g/mol. Its IUPAC name is 2-[(E)-4,8-dimethylnon-3-enyl]-2-methyl-6-(4-methylpentyl)-1H-anthracene-9,10-diol.
| Compound Name | 2-[(E)-4,8-dimethylnon-3-enyl]-2-methyl-6-(4-methylpentyl)-1H-anthracene-9,10-diol |
|---|---|
| PubChem CID | 134297771 |
| Molecular Formula | C32H46O2 |
| Molecular Weight | 462.72 g/mol |
| Exact Mass | 462.35 |
| IUPAC Name | 2-[(E)-4,8-dimethylnon-3-enyl]-2-methyl-6-(4-methylpentyl)-1H-anthracene-9,10-diol |
| SMILES | C/C(=C\CCC1(C)C=Cc2c(c(O)c3ccc(CCCC(C)C)cc3c2O)C1)CCCC(C)C |
| InChI | InChI=1S/C32H46O2/c1-22(2)10-7-12-24(5)13-9-18-32(6)19-17-27-29(21-32)31(34)26-16-15-25(14-8-11-23(3)4)20-28(26)30(27)33/h13,15-17,19-20,22-23,33-34H,7-12,14,18,21H2,1-6H3/b24-13+ |
| InChIKey | VUOFQMUCVOUTPW-ZMOGYAJESA-N |
| XLogP | 9.36 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.72 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|