C21H38O2 — CID 90239417
2-methyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7-dienyl]-1,3-dioxane (PubChem CID 90239417) has the molecular formula C21H38O2 and a molecular weight of 322.53 g/mol. Its IUPAC name is 2-methyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7-dienyl]-1,3-dioxane.
| Compound Name | 2-methyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7-dienyl]-1,3-dioxane |
|---|---|
| PubChem CID | 90239417 |
| Molecular Formula | C21H38O2 |
| Molecular Weight | 322.53 g/mol |
| Exact Mass | 322.29 |
| IUPAC Name | 2-methyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7-dienyl]-1,3-dioxane |
| SMILES | C/C(=C\CCC1(C)OCCCO1)CC/C=C(\C)CCCC(C)C |
| InChI | InChI=1S/C21H38O2/c1-18(2)10-6-11-19(3)12-7-13-20(4)14-8-15-21(5)22-16-9-17-23-21/h12,14,18H,6-11,13,15-17H2,1-5H3/b19-12+,20-14+ |
| InChIKey | DYOCZEZZQFFUAN-LCAIAVFMSA-N |
| XLogP | 6.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.53 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|