C22H40O2 — CID 90239404
2,4,5-trimethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7-dienyl]-1,3-dioxolane (PubChem CID 90239404) has the molecular formula C22H40O2 and a molecular weight of 336.56 g/mol. Its IUPAC name is 2,4,5-trimethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7-dienyl]-1,3-dioxolane.
| Compound Name | 2,4,5-trimethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7-dienyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 90239404 |
| Molecular Formula | C22H40O2 |
| Molecular Weight | 336.56 g/mol |
| Exact Mass | 336.30 |
| IUPAC Name | 2,4,5-trimethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7-dienyl]-1,3-dioxolane |
| SMILES | C/C(=C\CCC1(C)OC(C)C(C)O1)CC/C=C(\C)CCCC(C)C |
| InChI | InChI=1S/C22H40O2/c1-17(2)11-8-12-18(3)13-9-14-19(4)15-10-16-22(7)23-20(5)21(6)24-22/h13,15,17,20-21H,8-12,14,16H2,1-7H3/b18-13+,19-15+ |
| InChIKey | XOKSBPBRNOOVJF-HQSZAHFGSA-N |
| XLogP | 6.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.56 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|