C36H66O4 — CID 139326839
2-[(3Z)-4,8-dimethylnona-3,7-dienyl]-2,5,5-trimethyl-1,3-dioxane;2-[(Z)-4,8-dimethylnon-3-enyl]-2,5,5-trimethyl-1,3-dioxane (PubChem CID 139326839) has the molecular formula C36H66O4 and a molecular weight of 562.92 g/mol. Its IUPAC name is 2-[(3Z)-4,8-dimethylnona-3,7-dienyl]-2,5,5-trimethyl-1,3-dioxane;2-[(Z)-4,8-dimethylnon-3-enyl]-2,5,5-trimethyl-1,3-dioxane.
| Compound Name | 2-[(3Z)-4,8-dimethylnona-3,7-dienyl]-2,5,5-trimethyl-1,3-dioxane;2-[(Z)-4,8-dimethylnon-3-enyl]-2,5,5-trimethyl-1,3-dioxane |
|---|---|
| PubChem CID | 139326839 |
| Molecular Formula | C36H66O4 |
| Molecular Weight | 562.92 g/mol |
| Exact Mass | 562.50 |
| IUPAC Name | 2-[(3Z)-4,8-dimethylnona-3,7-dienyl]-2,5,5-trimethyl-1,3-dioxane;2-[(Z)-4,8-dimethylnon-3-enyl]-2,5,5-trimethyl-1,3-dioxane |
| SMILES | C/C(=C/CCC1(C)OCC(C)(C)CO1)CCCC(C)C.CC(C)=CCC/C(C)=C\CCC1(C)OCC(C)(C)CO1 |
| InChI | InChI=1S/C18H34O2.C18H32O2/c2*1-15(2)9-7-10-16(3)11-8-12-18(6)19-13-17(4,5)14-20-18/h11,15H,7-10,12-14H2,1-6H3;9,11H,7-8,10,12-14H2,1-6H3/b2*16-11- |
| InChIKey | UPPNKIIBLXILSM-INAVFROGSA-N |
| XLogP | 10.58 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.92 |
| LogP ≤ 5 | 10.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|