C20H32O2 — CID 141403807
2-methyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-1,3-dioxole (PubChem CID 141403807) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is 2-methyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-1,3-dioxole.
| Compound Name | 2-methyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-1,3-dioxole |
|---|---|
| PubChem CID | 141403807 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | 2-methyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-1,3-dioxole |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CCC1(C)OC=CO1 |
| InChI | InChI=1S/C20H32O2/c1-17(2)9-6-10-18(3)11-7-12-19(4)13-8-14-20(5)21-15-16-22-20/h9,11,13,15-16H,6-8,10,12,14H2,1-5H3/b18-11+,19-13+ |
| InChIKey | ANCRJOHDJKXJDT-NWLVNBMCSA-N |
| XLogP | 6.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|