C16H26O — CID 42600655
(2R,3R)-2-[(3E)-4,8-dimethylnona-3,7-dienyl]-3-ethenyl-2-methyloxirane (PubChem CID 42600655) has the molecular formula C16H26O and a molecular weight of 234.38 g/mol. Its IUPAC name is (2R,3R)-2-[(3E)-4,8-dimethylnona-3,7-dienyl]-3-ethenyl-2-methyloxirane.
| Compound Name | (2R,3R)-2-[(3E)-4,8-dimethylnona-3,7-dienyl]-3-ethenyl-2-methyloxirane |
|---|---|
| PubChem CID | 42600655 |
| Molecular Formula | C16H26O |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 234.20 |
| IUPAC Name | (2R,3R)-2-[(3E)-4,8-dimethylnona-3,7-dienyl]-3-ethenyl-2-methyloxirane |
| SMILES | C=C[C@H]1O[C@]1(C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C16H26O/c1-6-15-16(5,17-15)12-8-11-14(4)10-7-9-13(2)3/h6,9,11,15H,1,7-8,10,12H2,2-5H3/b14-11+/t15-,16-/m1/s1 |
| InChIKey | TZFRZINFVBRQHQ-GSEJNISDSA-N |
| XLogP | 4.80 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.38 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|