C20H34O3 — CID 162904615
(E)-2-[2-[(2R,3R)-3-[(3E)-4,8-dimethylnona-3,7-dienyl]-3-methyloxiran-2-yl]ethyl]but-2-ene-1,4-diol (PubChem CID 162904615) has the molecular formula C20H34O3 and a molecular weight of 322.49 g/mol. Its IUPAC name is (E)-2-[2-[(2R,3R)-3-[(3E)-4,8-dimethylnona-3,7-dienyl]-3-methyloxiran-2-yl]ethyl]but-2-ene-1,4-diol.
| Compound Name | (E)-2-[2-[(2R,3R)-3-[(3E)-4,8-dimethylnona-3,7-dienyl]-3-methyloxiran-2-yl]ethyl]but-2-ene-1,4-diol |
|---|---|
| PubChem CID | 162904615 |
| Molecular Formula | C20H34O3 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | (E)-2-[2-[(2R,3R)-3-[(3E)-4,8-dimethylnona-3,7-dienyl]-3-methyloxiran-2-yl]ethyl]but-2-ene-1,4-diol |
| SMILES | CC(C)=CCC/C(C)=C/CC[C@@]1(C)O[C@@H]1CC/C(=C\CO)CO |
| InChI | InChI=1S/C20H34O3/c1-16(2)7-5-8-17(3)9-6-13-20(4)19(23-20)11-10-18(15-22)12-14-21/h7,9,12,19,21-22H,5-6,8,10-11,13-15H2,1-4H3/b17-9+,18-12+/t19-,20-/m1/s1 |
| InChIKey | LFYMJFPNNFFEMZ-WWPZXGFGSA-N |
| XLogP | 4.31 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|