C10H18O2 — CID 101259052
[(3S)-3-methyl-3-(4-methylpent-3-enyl)oxiran-2-yl]methanol (PubChem CID 101259052) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is [(3S)-3-methyl-3-(4-methylpent-3-enyl)oxiran-2-yl]methanol.
| Compound Name | [(3S)-3-methyl-3-(4-methylpent-3-enyl)oxiran-2-yl]methanol |
|---|---|
| PubChem CID | 101259052 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | [(3S)-3-methyl-3-(4-methylpent-3-enyl)oxiran-2-yl]methanol |
| SMILES | CC(C)=CCC[C@]1(C)OC1CO |
| InChI | InChI=1S/C10H18O2/c1-8(2)5-4-6-10(3)9(7-11)12-10/h5,9,11H,4,6-7H2,1-3H3/t9?,10-/m0/s1 |
| InChIKey | RZRBXGPSHVAUQO-AXDSSHIGSA-N |
| XLogP | 1.88 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|