C10H17BrO — CID 121298365
(2S)-3-(bromomethyl)-2-methyl-2-(4-methylpent-3-enyl)oxirane (PubChem CID 121298365) has the molecular formula C10H17BrO and a molecular weight of 233.15 g/mol. Its IUPAC name is (2S)-3-(bromomethyl)-2-methyl-2-(4-methylpent-3-enyl)oxirane.
| Compound Name | (2S)-3-(bromomethyl)-2-methyl-2-(4-methylpent-3-enyl)oxirane |
|---|---|
| PubChem CID | 121298365 |
| Molecular Formula | C10H17BrO |
| Molecular Weight | 233.15 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | (2S)-3-(bromomethyl)-2-methyl-2-(4-methylpent-3-enyl)oxirane |
| SMILES | CC(C)=CCC[C@]1(C)OC1CBr |
| InChI | InChI=1S/C10H17BrO/c1-8(2)5-4-6-10(3)9(7-11)12-10/h5,9H,4,6-7H2,1-3H3/t9?,10-/m0/s1 |
| InChIKey | YBLCNHAYWVYVPC-AXDSSHIGSA-N |
| XLogP | 3.29 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.15 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|