C30H52O4 — CID 101054072
(E,3S)-9-[(2S,3S)-3-[2-[(2S,3S)-3-[(3E)-4,8-dimethylnona-3,7-dienyl]-3-methyloxiran-2-yl]ethyl]-2-methyloxiran-2-yl]-2,6-dimethylnon-6-ene-2,3-diol (PubChem CID 101054072) has the molecular formula C30H52O4 and a molecular weight of 476.74 g/mol. Its IUPAC name is (E,3S)-9-[(2S,3S)-3-[2-[(2S,3S)-3-[(3E)-4,8-dimethylnona-3,7-dienyl]-3-methyloxiran-2-yl]ethyl]-2-methyloxiran-2-yl]-2,6-dimethylnon-6-ene-2,3-diol.
| Compound Name | (E,3S)-9-[(2S,3S)-3-[2-[(2S,3S)-3-[(3E)-4,8-dimethylnona-3,7-dienyl]-3-methyloxiran-2-yl]ethyl]-2-methyloxiran-2-yl]-2,6-dimethylnon-6-ene-2,3-diol |
|---|---|
| PubChem CID | 101054072 |
| Molecular Formula | C30H52O4 |
| Molecular Weight | 476.74 g/mol |
| Exact Mass | 476.39 |
| IUPAC Name | (E,3S)-9-[(2S,3S)-3-[2-[(2S,3S)-3-[(3E)-4,8-dimethylnona-3,7-dienyl]-3-methyloxiran-2-yl]ethyl]-2-methyloxiran-2-yl]-2,6-dimethylnon-6-ene-2,3-diol |
| SMILES | CC(C)=CCC/C(C)=C/CC[C@]1(C)O[C@H]1CC[C@@H]1O[C@@]1(C)CC/C=C(\C)CC[C@H](O)C(C)(C)O |
| InChI | InChI=1S/C30H52O4/c1-22(2)12-9-13-23(3)14-10-20-29(7)26(33-29)18-19-27-30(8,34-27)21-11-15-24(4)16-17-25(31)28(5,6)32/h12,14-15,25-27,31-32H,9-11,13,16-21H2,1-8H3/b23-14+,24-15+/t25-,26-,27-,29-,30-/m0/s1 |
| InChIKey | JYXNTKPKOSZOAY-NAHYMLTQSA-N |
| XLogP | 7.19 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.74 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|