C34H58O8 — CID 101130432
[(3S,4R)-1-[(2S,3R)-3-[2-[(2R,3S)-3-[(3S,4R)-3-acetyloxy-4-hydroxy-4,8-dimethylnon-7-enyl]-3-methyloxiran-2-yl]ethyl]-2-methyloxiran-2-yl]-4-hydroxy-4,8-dimethylnon-7-en-3-yl] acetate (PubChem CID 101130432) has the molecular formula C34H58O8 and a molecular weight of 594.83 g/mol. Its IUPAC name is [(3S,4R)-1-[(2S,3R)-3-[2-[(2R,3S)-3-[(3S,4R)-3-acetyloxy-4-hydroxy-4,8-dimethylnon-7-enyl]-3-methyloxiran-2-yl]ethyl]-2-methyloxiran-2-yl]-4-hydroxy-4,8-dimethylnon-7-en-3-yl] acetate.
| Compound Name | [(3S,4R)-1-[(2S,3R)-3-[2-[(2R,3S)-3-[(3S,4R)-3-acetyloxy-4-hydroxy-4,8-dimethylnon-7-enyl]-3-methyloxiran-2-yl]ethyl]-2-methyloxiran-2-yl]-4-hydroxy-4,8-dimethylnon-7-en-3-yl] acetate |
|---|---|
| PubChem CID | 101130432 |
| Molecular Formula | C34H58O8 |
| Molecular Weight | 594.83 g/mol |
| Exact Mass | 594.41 |
| IUPAC Name | [(3S,4R)-1-[(2S,3R)-3-[2-[(2R,3S)-3-[(3S,4R)-3-acetyloxy-4-hydroxy-4,8-dimethylnon-7-enyl]-3-methyloxiran-2-yl]ethyl]-2-methyloxiran-2-yl]-4-hydroxy-4,8-dimethylnon-7-en-3-yl] acetate |
| SMILES | CC(=O)O[C@@H](CC[C@]1(C)O[C@@H]1CC[C@H]1O[C@@]1(C)CC[C@H](OC(C)=O)[C@](C)(O)CCC=C(C)C)[C@](C)(O)CCC=C(C)C |
| InChI | InChI=1S/C34H58O8/c1-23(2)13-11-19-31(7,37)27(39-25(5)35)17-21-33(9)29(41-33)15-16-30-34(10,42-30)22-18-28(40-26(6)36)32(8,38)20-12-14-24(3)4/h13-14,27-30,37-38H,11-12,15-22H2,1-10H3/t27-,28-,29+,30+,31+,32+,33-,34-/m0/s1 |
| InChIKey | OXMCWUYGHSNTPP-PMYZHRLVSA-N |
| XLogP | 6.50 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.83 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|