C32H56O6 — CID 162857234
[(1S,4S,5S)-4,5-dihydroxy-1-[(2R,5S)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-4,9,13,17-tetramethyloctadeca-8,12,16-trienyl] acetate (PubChem CID 162857234) has the molecular formula C32H56O6 and a molecular weight of 536.79 g/mol. Its IUPAC name is [(1S,4S,5S)-4,5-dihydroxy-1-[(2R,5S)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-4,9,13,17-tetramethyloctadeca-8,12,16-trienyl] acetate.
| Compound Name | [(1S,4S,5S)-4,5-dihydroxy-1-[(2R,5S)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-4,9,13,17-tetramethyloctadeca-8,12,16-trienyl] acetate |
|---|---|
| PubChem CID | 162857234 |
| Molecular Formula | C32H56O6 |
| Molecular Weight | 536.79 g/mol |
| Exact Mass | 536.41 |
| IUPAC Name | [(1S,4S,5S)-4,5-dihydroxy-1-[(2R,5S)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-4,9,13,17-tetramethyloctadeca-8,12,16-trienyl] acetate |
| SMILES | CC(=O)O[C@@H](CC[C@](C)(O)[C@@H](O)CCC=C(C)CCC=C(C)CCC=C(C)C)[C@@]1(C)CC[C@@H](C(C)(C)O)O1 |
| InChI | InChI=1S/C32H56O6/c1-23(2)13-10-14-24(3)15-11-16-25(4)17-12-18-27(34)31(8,36)21-19-29(37-26(5)33)32(9)22-20-28(38-32)30(6,7)35/h13,15,17,27-29,34-36H,10-12,14,16,18-22H2,1-9H3/t27-,28-,29-,31-,32+/m0/s1 |
| InChIKey | PINMHLZNDLPVLP-JONZOVCNSA-N |
| XLogP | 6.72 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.79 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|