C22H38O5 — CID 101251988
[(2E,6Z,10S)-10-hydroxy-10-[(2S,5R)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-3,7-dimethyldeca-2,6-dienyl] acetate (PubChem CID 101251988) has the molecular formula C22H38O5 and a molecular weight of 382.54 g/mol. Its IUPAC name is [(2E,6Z,10S)-10-hydroxy-10-[(2S,5R)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-3,7-dimethyldeca-2,6-dienyl] acetate.
| Compound Name | [(2E,6Z,10S)-10-hydroxy-10-[(2S,5R)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-3,7-dimethyldeca-2,6-dienyl] acetate |
|---|---|
| PubChem CID | 101251988 |
| Molecular Formula | C22H38O5 |
| Molecular Weight | 382.54 g/mol |
| Exact Mass | 382.27 |
| IUPAC Name | [(2E,6Z,10S)-10-hydroxy-10-[(2S,5R)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-3,7-dimethyldeca-2,6-dienyl] acetate |
| SMILES | CC(=O)OC/C=C(\C)CC/C=C(/C)CC[C@H](O)[C@]1(C)CC[C@H](C(C)(C)O)O1 |
| InChI | InChI=1S/C22H38O5/c1-16(8-7-9-17(2)13-15-26-18(3)23)10-11-19(24)22(6)14-12-20(27-22)21(4,5)25/h8,13,19-20,24-25H,7,9-12,14-15H2,1-6H3/b16-8-,17-13+/t19-,20+,22-/m0/s1 |
| InChIKey | BLMUUYNRXPXZOC-KXXOKYDNSA-N |
| XLogP | 4.07 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.54 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|