C45H84O7 — CID 95224359
(2E,6E,10E,15S,19S,23S,27S)-30-[(2R,5R)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-3,7,11,15,19,23,27-heptamethyltriaconta-2,6,10-triene-1,15,19,23,27-pentol (PubChem CID 95224359) has the molecular formula C45H84O7 and a molecular weight of 737.16 g/mol. Its IUPAC name is (2E,6E,10E,15S,19S,23S,27S)-30-[(2R,5R)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-3,7,11,15,19,23,27-heptamethyltriaconta-2,6,10-triene-1,15,19,23,27-pentol.
| Compound Name | (2E,6E,10E,15S,19S,23S,27S)-30-[(2R,5R)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-3,7,11,15,19,23,27-heptamethyltriaconta-2,6,10-triene-1,15,19,23,27-pentol |
|---|---|
| PubChem CID | 95224359 |
| Molecular Formula | C45H84O7 |
| Molecular Weight | 737.16 g/mol |
| Exact Mass | 736.62 |
| IUPAC Name | (2E,6E,10E,15S,19S,23S,27S)-30-[(2R,5R)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-3,7,11,15,19,23,27-heptamethyltriaconta-2,6,10-triene-1,15,19,23,27-pentol |
| SMILES | C/C(=C\CO)CC/C=C(\C)CC/C=C(\C)CCC[C@](C)(O)CCC[C@](C)(O)CCC[C@](C)(O)CCC[C@](C)(O)CCC[C@]1(C)CC[C@H](C(C)(C)O)O1 |
| InChI | InChI=1S/C45H84O7/c1-36(19-12-21-38(3)24-35-46)18-11-20-37(2)22-13-25-41(6,48)26-14-27-42(7,49)28-15-29-43(8,50)30-16-31-44(9,51)32-17-33-45(10)34-23-39(52-45)40(4,5)47/h19-20,24,39,46-51H,11-18,21-23,25-35H2,1-10H3/b36-19+,37-20+,38-24+/t39-,41+,42+,43+,44+,45-/m1/s1 |
| InChIKey | NBGBZMBMYVORQK-MKISQJCZSA-N |
| XLogP | 9.94 |
| TPSA | 130.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.16 |
| LogP ≤ 5 | 9.94 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|