C40H74O6 — CID 171344868
(2E,6E,10E)-26-[4-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-3,7,11,15,19,23-hexamethylhexacosa-2,6,10-triene-1,15,19,23-tetrol (PubChem CID 171344868) has the molecular formula C40H74O6 and a molecular weight of 651.03 g/mol. Its IUPAC name is (2E,6E,10E)-26-[4-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-3,7,11,15,19,23-hexamethylhexacosa-2,6,10-triene-1,15,19,23-tetrol.
| Compound Name | (2E,6E,10E)-26-[4-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-3,7,11,15,19,23-hexamethylhexacosa-2,6,10-triene-1,15,19,23-tetrol |
|---|---|
| PubChem CID | 171344868 |
| Molecular Formula | C40H74O6 |
| Molecular Weight | 651.03 g/mol |
| Exact Mass | 650.55 |
| IUPAC Name | (2E,6E,10E)-26-[4-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-3,7,11,15,19,23-hexamethylhexacosa-2,6,10-triene-1,15,19,23-tetrol |
| SMILES | C/C(=C\CO)CC/C=C(\C)CC/C=C(\C)CCCC(C)(O)CCCC(C)(O)CCCC(C)(O)CCCC1(C)CC(C(C)(C)O)CO1 |
| InChI | InChI=1S/C40H74O6/c1-32(17-11-19-34(3)21-29-41)16-10-18-33(2)20-12-22-37(6,43)23-13-24-38(7,44)25-14-26-39(8,45)27-15-28-40(9)30-35(31-46-40)36(4,5)42/h17-18,21,35,41-45H,10-16,19-20,22-31H2,1-9H3/b32-17+,33-18+,34-21+ |
| InChIKey | ICIXZWXWCLZICQ-MBVDHRCYSA-N |
| XLogP | 8.88 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.03 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|