C16H28O — CID 15599953
(5E)-2-cyclopropyl-6,10-dimethylundeca-5,9-dien-2-ol (PubChem CID 15599953) has the molecular formula C16H28O and a molecular weight of 236.40 g/mol. Its IUPAC name is (5E)-2-cyclopropyl-6,10-dimethylundeca-5,9-dien-2-ol.
| Compound Name | (5E)-2-cyclopropyl-6,10-dimethylundeca-5,9-dien-2-ol |
|---|---|
| PubChem CID | 15599953 |
| Molecular Formula | C16H28O |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.21 |
| IUPAC Name | (5E)-2-cyclopropyl-6,10-dimethylundeca-5,9-dien-2-ol |
| SMILES | CC(C)=CCC/C(C)=C/CCC(C)(O)C1CC1 |
| InChI | InChI=1S/C16H28O/c1-13(2)7-5-8-14(3)9-6-12-16(4,17)15-10-11-15/h7,9,15,17H,5-6,8,10-12H2,1-4H3/b14-9+ |
| InChIKey | CGZJVJYLLSMCDK-NTEUORMPSA-N |
| XLogP | 4.62 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|