C13H24O — CID 24976055
(4Z)-2,5,9-trimethyldeca-4,8-dien-2-ol (PubChem CID 24976055) has the molecular formula C13H24O and a molecular weight of 196.33 g/mol. Its IUPAC name is (4Z)-2,5,9-trimethyldeca-4,8-dien-2-ol.
| Compound Name | (4Z)-2,5,9-trimethyldeca-4,8-dien-2-ol |
|---|---|
| PubChem CID | 24976055 |
| Molecular Formula | C13H24O |
| Molecular Weight | 196.33 g/mol |
| Exact Mass | 196.18 |
| IUPAC Name | (4Z)-2,5,9-trimethyldeca-4,8-dien-2-ol |
| SMILES | CC(C)=CCC/C(C)=C\CC(C)(C)O |
| InChI | InChI=1S/C13H24O/c1-11(2)7-6-8-12(3)9-10-13(4,5)14/h7,9,14H,6,8,10H2,1-5H3/b12-9- |
| InChIKey | HHNBUPVRDBTSJX-XFXZXTDPSA-N |
| XLogP | 3.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.33 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|