C40H65I — CID 54091067
13-(2,6-dimethylhepta-1,5-dienyl)-13-iodo-2,6,10,16,20,24-hexamethylpentacosa-2,6,10,15,19,23-hexaene (PubChem CID 54091067) has the molecular formula C40H65I and a molecular weight of 672.86 g/mol. Its IUPAC name is 13-(2,6-dimethylhepta-1,5-dienyl)-13-iodo-2,6,10,16,20,24-hexamethylpentacosa-2,6,10,15,19,23-hexaene.
| Compound Name | 13-(2,6-dimethylhepta-1,5-dienyl)-13-iodo-2,6,10,16,20,24-hexamethylpentacosa-2,6,10,15,19,23-hexaene |
|---|---|
| PubChem CID | 54091067 |
| Molecular Formula | C40H65I |
| Molecular Weight | 672.86 g/mol |
| Exact Mass | 672.41 |
| IUPAC Name | 13-(2,6-dimethylhepta-1,5-dienyl)-13-iodo-2,6,10,16,20,24-hexamethylpentacosa-2,6,10,15,19,23-hexaene |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCC(I)(C=C(C)CCC=C(C)C)CC=C(C)CCC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C40H65I/c1-32(2)17-12-20-35(7)22-15-24-37(9)27-29-40(41,31-39(11)26-14-19-34(5)6)30-28-38(10)25-16-23-36(8)21-13-18-33(3)4/h17-19,22-23,27-28,31H,12-16,20-21,24-26,29-30H2,1-11H3 |
| InChIKey | MTWSQQYUOIWXDF-UHFFFAOYSA-N |
| XLogP | 14.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.86 |
| LogP ≤ 5 | 14.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|