C32H54O3 — CID 54055377
1-[1,1-bis(3,7-dimethylocta-2,6-dienoxy)ethoxy]-3,7-dimethylocta-2,6-diene (PubChem CID 54055377) has the molecular formula C32H54O3 and a molecular weight of 486.78 g/mol. Its IUPAC name is 1-[1,1-bis(3,7-dimethylocta-2,6-dienoxy)ethoxy]-3,7-dimethylocta-2,6-diene.
| Compound Name | 1-[1,1-bis(3,7-dimethylocta-2,6-dienoxy)ethoxy]-3,7-dimethylocta-2,6-diene |
|---|---|
| PubChem CID | 54055377 |
| Molecular Formula | C32H54O3 |
| Molecular Weight | 486.78 g/mol |
| Exact Mass | 486.41 |
| IUPAC Name | 1-[1,1-bis(3,7-dimethylocta-2,6-dienoxy)ethoxy]-3,7-dimethylocta-2,6-diene |
| SMILES | CC(C)=CCCC(C)=CCOC(C)(OCC=C(C)CCC=C(C)C)OCC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C32H54O3/c1-26(2)14-11-17-29(7)20-23-33-32(10,34-24-21-30(8)18-12-15-27(3)4)35-25-22-31(9)19-13-16-28(5)6/h14-16,20-22H,11-13,17-19,23-25H2,1-10H3 |
| InChIKey | LVWCAKMZEKPMNK-UHFFFAOYSA-N |
| XLogP | 9.79 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.78 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|