C14H26O2 — CID 10082427
(2E)-1-(2-methoxypropan-2-yloxy)-3,7-dimethylocta-2,6-diene (PubChem CID 10082427) has the molecular formula C14H26O2 and a molecular weight of 226.36 g/mol. Its IUPAC name is (2E)-1-(2-methoxypropan-2-yloxy)-3,7-dimethylocta-2,6-diene.
| Compound Name | (2E)-1-(2-methoxypropan-2-yloxy)-3,7-dimethylocta-2,6-diene |
|---|---|
| PubChem CID | 10082427 |
| Molecular Formula | C14H26O2 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | (2E)-1-(2-methoxypropan-2-yloxy)-3,7-dimethylocta-2,6-diene |
| SMILES | COC(C)(C)OC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C14H26O2/c1-12(2)8-7-9-13(3)10-11-16-14(4,5)15-6/h8,10H,7,9,11H2,1-6H3/b13-10+ |
| InChIKey | UWYFUZLLWUEJOQ-JLHYYAGUSA-N |
| XLogP | 4.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|