C51H86O9 — CID 171120626
2-[(2E,6E)-11,15,19,23,27,31-hexahydroxy-3,7,11,15,19,23,27,31-octamethyldotriaconta-2,6-dienyl]-3-hydroxy-3-methyl-2H-naphthalene-1,4-dione (PubChem CID 171120626) has the molecular formula C51H86O9 and a molecular weight of 843.24 g/mol. Its IUPAC name is 2-[(2E,6E)-11,15,19,23,27,31-hexahydroxy-3,7,11,15,19,23,27,31-octamethyldotriaconta-2,6-dienyl]-3-hydroxy-3-methyl-2H-naphthalene-1,4-dione.
| Compound Name | 2-[(2E,6E)-11,15,19,23,27,31-hexahydroxy-3,7,11,15,19,23,27,31-octamethyldotriaconta-2,6-dienyl]-3-hydroxy-3-methyl-2H-naphthalene-1,4-dione |
|---|---|
| PubChem CID | 171120626 |
| Molecular Formula | C51H86O9 |
| Molecular Weight | 843.24 g/mol |
| Exact Mass | 842.63 |
| IUPAC Name | 2-[(2E,6E)-11,15,19,23,27,31-hexahydroxy-3,7,11,15,19,23,27,31-octamethyldotriaconta-2,6-dienyl]-3-hydroxy-3-methyl-2H-naphthalene-1,4-dione |
| SMILES | C/C(=C\CC1C(=O)c2ccccc2C(=O)C1(C)O)CC/C=C(\C)CCCC(C)(O)CCCC(C)(O)CCCC(C)(O)CCCC(C)(O)CCCC(C)(O)CCCC(C)(C)O |
| InChI | InChI=1S/C51H86O9/c1-38(20-13-21-39(2)25-26-42-43(52)40-23-11-12-24-41(40)44(53)51(42,10)60)22-14-28-46(5,55)30-16-32-48(7,57)34-18-36-50(9,59)37-19-35-49(8,58)33-17-31-47(6,56)29-15-27-45(3,4)54/h11-12,20,23-25,42,54-60H,13-19,21-22,26-37H2,1-10H3/b38-20+,39-25+ |
| InChIKey | LIMRANXYTRJBSS-GMCNMTGBSA-N |
| XLogP | 10.04 |
| TPSA | 175.75 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 843.24 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|