C24H40O5 — CID 66794142
4-hydroxy-5-(11-hydroxy-3,7,11-trimethyldodeca-2,6-dienyl)-2,3-dimethoxy-6-methylcyclohex-2-en-1-one (PubChem CID 66794142) has the molecular formula C24H40O5 and a molecular weight of 408.58 g/mol. Its IUPAC name is 4-hydroxy-5-(11-hydroxy-3,7,11-trimethyldodeca-2,6-dienyl)-2,3-dimethoxy-6-methylcyclohex-2-en-1-one.
| Compound Name | 4-hydroxy-5-(11-hydroxy-3,7,11-trimethyldodeca-2,6-dienyl)-2,3-dimethoxy-6-methylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 66794142 |
| Molecular Formula | C24H40O5 |
| Molecular Weight | 408.58 g/mol |
| Exact Mass | 408.29 |
| IUPAC Name | 4-hydroxy-5-(11-hydroxy-3,7,11-trimethyldodeca-2,6-dienyl)-2,3-dimethoxy-6-methylcyclohex-2-en-1-one |
| SMILES | COC1=C(OC)C(O)C(CC=C(C)CCC=C(C)CCCC(C)(C)O)C(C)C1=O |
| InChI | InChI=1S/C24H40O5/c1-16(12-9-15-24(4,5)27)10-8-11-17(2)13-14-19-18(3)20(25)22(28-6)23(29-7)21(19)26/h10,13,18-19,21,26-27H,8-9,11-12,14-15H2,1-7H3 |
| InChIKey | WUMLOGXKIKNTPT-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.58 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|