C26H44N2O3 — CID 130357896
(4S,5S,6S)-3-(3-aminopropylamino)-4-hydroxy-2-methoxy-6-methyl-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-en-1-one (PubChem CID 130357896) has the molecular formula C26H44N2O3 and a molecular weight of 432.65 g/mol. Its IUPAC name is (4S,5S,6S)-3-(3-aminopropylamino)-4-hydroxy-2-methoxy-6-methyl-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-en-1-one.
| Compound Name | (4S,5S,6S)-3-(3-aminopropylamino)-4-hydroxy-2-methoxy-6-methyl-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 130357896 |
| Molecular Formula | C26H44N2O3 |
| Molecular Weight | 432.65 g/mol |
| Exact Mass | 432.34 |
| IUPAC Name | (4S,5S,6S)-3-(3-aminopropylamino)-4-hydroxy-2-methoxy-6-methyl-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-en-1-one |
| SMILES | COC1=C(NCCCN)[C@@H](O)[C@@H](C/C=C(\C)CC/C=C(\C)CCC=C(C)C)[C@H](C)C1=O |
| InChI | InChI=1S/C26H44N2O3/c1-18(2)10-7-11-19(3)12-8-13-20(4)14-15-22-21(5)24(29)26(31-6)23(25(22)30)28-17-9-16-27/h10,12,14,21-22,25,28,30H,7-9,11,13,15-17,27H2,1-6H3/b19-12+,20-14+/t21-,22-,25-/m0/s1 |
| InChIKey | VOOCSJAKJVVFHW-ZXCDZNHVSA-N |
| XLogP | 4.79 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.65 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|