C26H43NO3 — CID 130357939
(4S,5S,6S)-3-(dimethylamino)-6-ethyl-4-hydroxy-2-methoxy-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-en-1-one (PubChem CID 130357939) has the molecular formula C26H43NO3 and a molecular weight of 417.63 g/mol. Its IUPAC name is (4S,5S,6S)-3-(dimethylamino)-6-ethyl-4-hydroxy-2-methoxy-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-en-1-one.
| Compound Name | (4S,5S,6S)-3-(dimethylamino)-6-ethyl-4-hydroxy-2-methoxy-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 130357939 |
| Molecular Formula | C26H43NO3 |
| Molecular Weight | 417.63 g/mol |
| Exact Mass | 417.32 |
| IUPAC Name | (4S,5S,6S)-3-(dimethylamino)-6-ethyl-4-hydroxy-2-methoxy-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-en-1-one |
| SMILES | CC[C@@H]1C(=O)C(OC)=C(N(C)C)[C@@H](O)[C@H]1C/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C26H43NO3/c1-9-21-22(24(28)23(27(6)7)26(30-8)25(21)29)17-16-20(5)15-11-14-19(4)13-10-12-18(2)3/h12,14,16,21-22,24,28H,9-11,13,15,17H2,1-8H3/b19-14+,20-16+/t21-,22-,24-/m0/s1 |
| InChIKey | YSHJDFRDVUJNLD-WCBXTVKTSA-N |
| XLogP | 5.80 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.63 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|