C29H45NO3S — CID 130357976
(4S,5S,6S)-2-methoxy-6-methyl-3-[methyl(thiophen-2-ylmethyl)amino]-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-ene-1,4-diol (PubChem CID 130357976) has the molecular formula C29H45NO3S and a molecular weight of 487.75 g/mol. Its IUPAC name is (4S,5S,6S)-2-methoxy-6-methyl-3-[methyl(thiophen-2-ylmethyl)amino]-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-ene-1,4-diol.
| Compound Name | (4S,5S,6S)-2-methoxy-6-methyl-3-[methyl(thiophen-2-ylmethyl)amino]-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-ene-1,4-diol |
|---|---|
| PubChem CID | 130357976 |
| Molecular Formula | C29H45NO3S |
| Molecular Weight | 487.75 g/mol |
| Exact Mass | 487.31 |
| IUPAC Name | (4S,5S,6S)-2-methoxy-6-methyl-3-[methyl(thiophen-2-ylmethyl)amino]-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-ene-1,4-diol |
| SMILES | COC1=C(N(C)Cc2cccs2)[C@@H](O)[C@@H](C/C=C(\C)CC/C=C(\C)CCC=C(C)C)[C@H](C)C1O |
| InChI | InChI=1S/C29H45NO3S/c1-20(2)11-8-12-21(3)13-9-14-22(4)16-17-25-23(5)27(31)29(33-7)26(28(25)32)30(6)19-24-15-10-18-34-24/h10-11,13,15-16,18,23,25,27-28,31-32H,8-9,12,14,17,19H2,1-7H3/b21-13+,22-16+/t23-,25-,27?,28-/m0/s1 |
| InChIKey | IKAZKYANOFDTOI-FVRFXLTGSA-N |
| XLogP | 6.83 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.75 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|