C39H56O2 — CID 102439475
2-[(2E,6E,10E,14E,18E)-3,7,11,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaenyl]-2H-chromen-6-ol (PubChem CID 102439475) has the molecular formula C39H56O2 and a molecular weight of 556.88 g/mol. Its IUPAC name is 2-[(2E,6E,10E,14E,18E)-3,7,11,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaenyl]-2H-chromen-6-ol.
| Compound Name | 2-[(2E,6E,10E,14E,18E)-3,7,11,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaenyl]-2H-chromen-6-ol |
|---|---|
| PubChem CID | 102439475 |
| Molecular Formula | C39H56O2 |
| Molecular Weight | 556.88 g/mol |
| Exact Mass | 556.43 |
| IUPAC Name | 2-[(2E,6E,10E,14E,18E)-3,7,11,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaenyl]-2H-chromen-6-ol |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC1C=Cc2cc(O)ccc2O1 |
| InChI | InChI=1S/C39H56O2/c1-30(2)13-8-14-31(3)15-9-16-32(4)17-10-18-33(5)19-11-20-34(6)21-12-22-35(7)23-26-38-27-24-36-29-37(40)25-28-39(36)41-38/h13,15,17,19,21,23-25,27-29,38,40H,8-12,14,16,18,20,22,26H2,1-7H3/b31-15+,32-17+,33-19+,34-21+,35-23+ |
| InChIKey | QFSYDJZCYMEOGR-NABOLCEGSA-N |
| XLogP | 12.16 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.88 |
| LogP ≤ 5 | 12.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|