C20H32OS — CID 164597146
3-methyl-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-2,5-dihydrothiophene 1-oxide (PubChem CID 164597146) has the molecular formula C20H32OS and a molecular weight of 320.54 g/mol. Its IUPAC name is 3-methyl-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-2,5-dihydrothiophene 1-oxide.
| Compound Name | 3-methyl-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-2,5-dihydrothiophene 1-oxide |
|---|---|
| PubChem CID | 164597146 |
| Molecular Formula | C20H32OS |
| Molecular Weight | 320.54 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | 3-methyl-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-2,5-dihydrothiophene 1-oxide |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC1C(C)=CCS1=O |
| InChI | InChI=1S/C20H32OS/c1-16(2)8-6-9-17(3)10-7-11-18(4)12-13-20-19(5)14-15-22(20)21/h8,10,12,14,20H,6-7,9,11,13,15H2,1-5H3/b17-10+,18-12+ |
| InChIKey | FVWZWFJCYFSKDK-VZRGJMDUSA-N |
| XLogP | 5.87 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.54 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|