C19H30O — CID 123941390
5-(3,7-dimethylocta-2,6-dienyl)-4,6-dimethylcyclohex-3-ene-1-carbaldehyde (PubChem CID 123941390) has the molecular formula C19H30O and a molecular weight of 274.45 g/mol. Its IUPAC name is 5-(3,7-dimethylocta-2,6-dienyl)-4,6-dimethylcyclohex-3-ene-1-carbaldehyde.
| Compound Name | 5-(3,7-dimethylocta-2,6-dienyl)-4,6-dimethylcyclohex-3-ene-1-carbaldehyde |
|---|---|
| PubChem CID | 123941390 |
| Molecular Formula | C19H30O |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.23 |
| IUPAC Name | 5-(3,7-dimethylocta-2,6-dienyl)-4,6-dimethylcyclohex-3-ene-1-carbaldehyde |
| SMILES | CC(C)=CCCC(C)=CCC1C(C)=CCC(C=O)C1C |
| InChI | InChI=1S/C19H30O/c1-14(2)7-6-8-15(3)9-12-19-16(4)10-11-18(13-20)17(19)5/h7,9-10,13,17-19H,6,8,11-12H2,1-5H3 |
| InChIKey | NOJXHUUURCGSJV-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|