C12H18O3S — CID 10060293
(E)-4-methyl-6-(3-methyl-1,1-dioxo-2,5-dihydrothiophen-2-yl)hex-4-enal (PubChem CID 10060293) has the molecular formula C12H18O3S and a molecular weight of 242.34 g/mol. Its IUPAC name is (E)-4-methyl-6-(3-methyl-1,1-dioxo-2,5-dihydrothiophen-2-yl)hex-4-enal.
| Compound Name | (E)-4-methyl-6-(3-methyl-1,1-dioxo-2,5-dihydrothiophen-2-yl)hex-4-enal |
|---|---|
| PubChem CID | 10060293 |
| Molecular Formula | C12H18O3S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | (E)-4-methyl-6-(3-methyl-1,1-dioxo-2,5-dihydrothiophen-2-yl)hex-4-enal |
| SMILES | CC1=CCS(=O)(=O)C1C/C=C(\C)CCC=O |
| InChI | InChI=1S/C12H18O3S/c1-10(4-3-8-13)5-6-12-11(2)7-9-16(12,14)15/h5,7-8,12H,3-4,6,9H2,1-2H3/b10-5+ |
| InChIKey | RATQZDIGOUBNDQ-BJMVGYQFSA-N |
| XLogP | 2.05 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|