C20H32O2S — CID 164597144
3-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-2,5-dihydrothiophene 1,1-dioxide (PubChem CID 164597144) has the molecular formula C20H32O2S and a molecular weight of 336.54 g/mol. Its IUPAC name is 3-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-2,5-dihydrothiophene 1,1-dioxide.
| Compound Name | 3-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-2,5-dihydrothiophene 1,1-dioxide |
|---|---|
| PubChem CID | 164597144 |
| Molecular Formula | C20H32O2S |
| Molecular Weight | 336.54 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | 3-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-2,5-dihydrothiophene 1,1-dioxide |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CCC1=CCS(=O)(=O)C1 |
| InChI | InChI=1S/C20H32O2S/c1-17(2)8-5-9-18(3)10-6-11-19(4)12-7-13-20-14-15-23(21,22)16-20/h8,10,12,14H,5-7,9,11,13,15-16H2,1-4H3/b18-10+,19-12+ |
| InChIKey | CJELZWSWFHUCSD-UBIAKTOFSA-N |
| XLogP | 5.54 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.54 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|