C33H54O — CID 162436720
(6E)-2,6-dimethyl-10-methylidenedodeca-2,6-diene;3-[(3E)-4,8-dimethylnona-3,7-dienyl]cyclohex-3-ene-1-carbaldehyde (PubChem CID 162436720) has the molecular formula C33H54O and a molecular weight of 466.79 g/mol. Its IUPAC name is (6E)-2,6-dimethyl-10-methylidenedodeca-2,6-diene;3-[(3E)-4,8-dimethylnona-3,7-dienyl]cyclohex-3-ene-1-carbaldehyde.
| Compound Name | (6E)-2,6-dimethyl-10-methylidenedodeca-2,6-diene;3-[(3E)-4,8-dimethylnona-3,7-dienyl]cyclohex-3-ene-1-carbaldehyde |
|---|---|
| PubChem CID | 162436720 |
| Molecular Formula | C33H54O |
| Molecular Weight | 466.79 g/mol |
| Exact Mass | 466.42 |
| IUPAC Name | (6E)-2,6-dimethyl-10-methylidenedodeca-2,6-diene;3-[(3E)-4,8-dimethylnona-3,7-dienyl]cyclohex-3-ene-1-carbaldehyde |
| SMILES | C=C(CC)CC/C=C(\C)CCC=C(C)C.CC(C)=CCC/C(C)=C/CCC1=CCCC(C=O)C1 |
| InChI | InChI=1S/C18H28O.C15H26/c1-15(2)7-4-8-16(3)9-5-10-17-11-6-12-18(13-17)14-19;1-6-14(4)10-8-12-15(5)11-7-9-13(2)3/h7,9,11,14,18H,4-6,8,10,12-13H2,1-3H3;9,12H,4,6-8,10-11H2,1-3,5H3/b16-9+;15-12+ |
| InChIKey | FCFHDXVIAHCSPN-GTTOFOQHSA-N |
| XLogP | 10.81 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.79 |
| LogP ≤ 5 | 10.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|