C38H60O4 — CID 161325290
methyl 3-[(3E)-4,8-dimethylnona-3,7-dienyl]cyclohex-3-ene-1-carboxylate (PubChem CID 161325290) has the molecular formula C38H60O4 and a molecular weight of 580.89 g/mol. Its IUPAC name is methyl 3-[(3E)-4,8-dimethylnona-3,7-dienyl]cyclohex-3-ene-1-carboxylate.
| Compound Name | methyl 3-[(3E)-4,8-dimethylnona-3,7-dienyl]cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 161325290 |
| Molecular Formula | C38H60O4 |
| Molecular Weight | 580.89 g/mol |
| Exact Mass | 580.45 |
| IUPAC Name | methyl 3-[(3E)-4,8-dimethylnona-3,7-dienyl]cyclohex-3-ene-1-carboxylate |
| SMILES | COC(=O)C1CCC=C(CC/C=C(\C)CCC=C(C)C)C1.COC(=O)C1CCC=C(CC/C=C(\C)CCC=C(C)C)C1 |
| InChI | InChI=1S/2C19H30O2/c2*1-15(2)8-5-9-16(3)10-6-11-17-12-7-13-18(14-17)19(20)21-4/h2*8,10,12,18H,5-7,9,11,13-14H2,1-4H3/b2*16-10+ |
| InChIKey | VKRMTKOTPKSAOQ-UDGBXGIMSA-N |
| XLogP | 10.72 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.89 |
| LogP ≤ 5 | 10.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|