C36H56O4 — CID 166933300
dimethyl (1S)-3-[(6E)-7,11-dimethyl-3-methylidenedodeca-6,10-dienyl]-5-[(3E)-4,8-dimethylnona-3,7-dienyl]cyclohex-4-ene-1,2-dicarboxylate (PubChem CID 166933300) has the molecular formula C36H56O4 and a molecular weight of 552.84 g/mol. Its IUPAC name is dimethyl (1S)-3-[(6E)-7,11-dimethyl-3-methylidenedodeca-6,10-dienyl]-5-[(3E)-4,8-dimethylnona-3,7-dienyl]cyclohex-4-ene-1,2-dicarboxylate.
| Compound Name | dimethyl (1S)-3-[(6E)-7,11-dimethyl-3-methylidenedodeca-6,10-dienyl]-5-[(3E)-4,8-dimethylnona-3,7-dienyl]cyclohex-4-ene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 166933300 |
| Molecular Formula | C36H56O4 |
| Molecular Weight | 552.84 g/mol |
| Exact Mass | 552.42 |
| IUPAC Name | dimethyl (1S)-3-[(6E)-7,11-dimethyl-3-methylidenedodeca-6,10-dienyl]-5-[(3E)-4,8-dimethylnona-3,7-dienyl]cyclohex-4-ene-1,2-dicarboxylate |
| SMILES | C=C(CC/C=C(\C)CCC=C(C)C)CCC1C=C(CC/C=C(\C)CCC=C(C)C)C[C@H](C(=O)OC)C1C(=O)OC |
| InChI | InChI=1S/C36H56O4/c1-26(2)14-10-16-28(5)18-12-19-30(7)22-23-32-24-31(21-13-20-29(6)17-11-15-27(3)4)25-33(35(37)39-8)34(32)36(38)40-9/h14-15,18,20,24,32-34H,7,10-13,16-17,19,21-23,25H2,1-6,8-9H3/b28-18+,29-20+/t32?,33-,34?/m0/s1 |
| InChIKey | RGHQZSPEDOFMLW-SPOKBERBSA-N |
| XLogP | 9.79 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.84 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|