C40H66N2O2 — CID 166933259
(1R,5S)-5-[(6E)-7,11-dimethyl-3-methylidenedodeca-6,10-dienyl]-3-[(3E)-4,8-dimethylnona-3,7-dienyl]-N-(3-morpholin-4-ylpropyl)cyclohex-3-ene-1-carboxamide (PubChem CID 166933259) has the molecular formula C40H66N2O2 and a molecular weight of 606.98 g/mol. Its IUPAC name is (1R,5S)-5-[(6E)-7,11-dimethyl-3-methylidenedodeca-6,10-dienyl]-3-[(3E)-4,8-dimethylnona-3,7-dienyl]-N-(3-morpholin-4-ylpropyl)cyclohex-3-ene-1-carboxamide.
| Compound Name | (1R,5S)-5-[(6E)-7,11-dimethyl-3-methylidenedodeca-6,10-dienyl]-3-[(3E)-4,8-dimethylnona-3,7-dienyl]-N-(3-morpholin-4-ylpropyl)cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 166933259 |
| Molecular Formula | C40H66N2O2 |
| Molecular Weight | 606.98 g/mol |
| Exact Mass | 606.51 |
| IUPAC Name | (1R,5S)-5-[(6E)-7,11-dimethyl-3-methylidenedodeca-6,10-dienyl]-3-[(3E)-4,8-dimethylnona-3,7-dienyl]-N-(3-morpholin-4-ylpropyl)cyclohex-3-ene-1-carboxamide |
| SMILES | C=C(CC/C=C(\C)CCC=C(C)C)CC[C@@H]1C=C(CC/C=C(\C)CCC=C(C)C)C[C@H](C(=O)NCCCN2CCOCC2)C1 |
| InChI | InChI=1S/C40H66N2O2/c1-32(2)13-8-15-34(5)17-10-18-36(7)21-22-38-29-37(20-11-19-35(6)16-9-14-33(3)4)30-39(31-38)40(43)41-23-12-24-42-25-27-44-28-26-42/h13-14,17,19,29,38-39H,7-12,15-16,18,20-28,30-31H2,1-6H3,(H,41,43)/b34-17+,35-19+/t38-,39+/m1/s1 |
| InChIKey | PMEJFMNFYPPREA-REJFRESISA-N |
| XLogP | 10.06 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.98 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|