C44H75IN2O4 — CID 162436800
(6E)-2,6-dimethyl-10-methylidenedodeca-2,6-diene;[(1S)-3-[(3E)-4,8-dimethylnona-3,7-dienyl]cyclohex-3-en-1-yl]methyl 4-(3-morpholin-4-ylpropylamino)-4-oxobutanoate;hydroiodide (PubChem CID 162436800) has the molecular formula C44H75IN2O4 and a molecular weight of 823.00 g/mol. Its IUPAC name is (6E)-2,6-dimethyl-10-methylidenedodeca-2,6-diene;[(1S)-3-[(3E)-4,8-dimethylnona-3,7-dienyl]cyclohex-3-en-1-yl]methyl 4-(3-morpholin-4-ylpropylamino)-4-oxobutanoate;hydroiodide.
| Compound Name | (6E)-2,6-dimethyl-10-methylidenedodeca-2,6-diene;[(1S)-3-[(3E)-4,8-dimethylnona-3,7-dienyl]cyclohex-3-en-1-yl]methyl 4-(3-morpholin-4-ylpropylamino)-4-oxobutanoate;hydroiodide |
|---|---|
| PubChem CID | 162436800 |
| Molecular Formula | C44H75IN2O4 |
| Molecular Weight | 823.00 g/mol |
| Exact Mass | 822.48 |
| IUPAC Name | (6E)-2,6-dimethyl-10-methylidenedodeca-2,6-diene;[(1S)-3-[(3E)-4,8-dimethylnona-3,7-dienyl]cyclohex-3-en-1-yl]methyl 4-(3-morpholin-4-ylpropylamino)-4-oxobutanoate;hydroiodide |
| SMILES | C=C(CC)CC/C=C(\C)CCC=C(C)C.CC(C)=CCC/C(C)=C/CCC1=CCC[C@H](COC(=O)CCC(=O)NCCCN2CCOCC2)C1.I |
| InChI | InChI=1S/C29H48N2O4.C15H26.HI/c1-24(2)8-4-9-25(3)10-5-11-26-12-6-13-27(22-26)23-35-29(33)15-14-28(32)30-16-7-17-31-18-20-34-21-19-31;1-6-14(4)10-8-12-15(5)11-7-9-13(2)3;/h8,10,12,27H,4-7,9,11,13-23H2,1-3H3,(H,30,32);9,12H,4,6-8,10-11H2,1-3,5H3;1H/b25-10+;15-12+;/t27-;;/m0../s1 |
| InChIKey | XAKZRBVRWRUXBZ-VFPHGUCMSA-N |
| XLogP | 11.39 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.00 |
| LogP ≤ 5 | 11.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|