C40H70N2O2 — CID 162436761
(6E)-2,6-dimethyl-10-methylidenedodeca-2,6-diene;1-[(3E)-4,8-dimethylnona-3,7-dienyl]cyclohexene;N-(3-morpholin-4-ylpropyl)formamide (PubChem CID 162436761) has the molecular formula C40H70N2O2 and a molecular weight of 611.01 g/mol. Its IUPAC name is (6E)-2,6-dimethyl-10-methylidenedodeca-2,6-diene;1-[(3E)-4,8-dimethylnona-3,7-dienyl]cyclohexene;N-(3-morpholin-4-ylpropyl)formamide.
| Compound Name | (6E)-2,6-dimethyl-10-methylidenedodeca-2,6-diene;1-[(3E)-4,8-dimethylnona-3,7-dienyl]cyclohexene;N-(3-morpholin-4-ylpropyl)formamide |
|---|---|
| PubChem CID | 162436761 |
| Molecular Formula | C40H70N2O2 |
| Molecular Weight | 611.01 g/mol |
| Exact Mass | 610.54 |
| IUPAC Name | (6E)-2,6-dimethyl-10-methylidenedodeca-2,6-diene;1-[(3E)-4,8-dimethylnona-3,7-dienyl]cyclohexene;N-(3-morpholin-4-ylpropyl)formamide |
| SMILES | C=C(CC)CC/C=C(\C)CCC=C(C)C.CC(C)=CCC/C(C)=C/CCC1=CCCCC1.O=CNCCCN1CCOCC1 |
| InChI | InChI=1S/C17H28.C15H26.C8H16N2O2/c1-15(2)9-7-10-16(3)11-8-14-17-12-5-4-6-13-17;1-6-14(4)10-8-12-15(5)11-7-9-13(2)3;11-8-9-2-1-3-10-4-6-12-7-5-10/h9,11-12H,4-8,10,13-14H2,1-3H3;9,12H,4,6-8,10-11H2,1-3,5H3;8H,1-7H2,(H,9,11)/b16-11+;15-12+; |
| InChIKey | FFCZADOPWAHBNG-WJMBDDEVSA-N |
| XLogP | 10.84 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.01 |
| LogP ≤ 5 | 10.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|