C32H51NO — CID 167089378
4-[3-[[2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-ethyl-5-pentylphenyl]methyl]but-3-enyl]morpholine (PubChem CID 167089378) has the molecular formula C32H51NO and a molecular weight of 465.77 g/mol. Its IUPAC name is 4-[3-[[2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-ethyl-5-pentylphenyl]methyl]but-3-enyl]morpholine.
| Compound Name | 4-[3-[[2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-ethyl-5-pentylphenyl]methyl]but-3-enyl]morpholine |
|---|---|
| PubChem CID | 167089378 |
| Molecular Formula | C32H51NO |
| Molecular Weight | 465.77 g/mol |
| Exact Mass | 465.40 |
| IUPAC Name | 4-[3-[[2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-ethyl-5-pentylphenyl]methyl]but-3-enyl]morpholine |
| SMILES | C=C(CCN1CCOCC1)Cc1cc(CCCCC)cc(CC)c1C/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C32H51NO/c1-7-9-10-14-29-24-30(8-2)32(16-15-27(5)13-11-12-26(3)4)31(25-29)23-28(6)17-18-33-19-21-34-22-20-33/h12,15,24-25H,6-11,13-14,16-23H2,1-5H3/b27-15+ |
| InChIKey | WYEKHKFBMLKQBY-JFLMPSFJSA-N |
| XLogP | 8.04 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.77 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|