C33H47NO8 — CID 167089237
(Z)-2-[4-[3-[2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-methoxy-5-pentylphenoxy]-3-oxopropyl]morpholin-3-yl]but-2-enedioic acid (PubChem CID 167089237) has the molecular formula C33H47NO8 and a molecular weight of 585.74 g/mol. Its IUPAC name is (Z)-2-[4-[3-[2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-methoxy-5-pentylphenoxy]-3-oxopropyl]morpholin-3-yl]but-2-enedioic acid.
| Compound Name | (Z)-2-[4-[3-[2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-methoxy-5-pentylphenoxy]-3-oxopropyl]morpholin-3-yl]but-2-enedioic acid |
|---|---|
| PubChem CID | 167089237 |
| Molecular Formula | C33H47NO8 |
| Molecular Weight | 585.74 g/mol |
| Exact Mass | 585.33 |
| IUPAC Name | (Z)-2-[4-[3-[2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-methoxy-5-pentylphenoxy]-3-oxopropyl]morpholin-3-yl]but-2-enedioic acid |
| SMILES | CCCCCc1cc(OC)c(C/C=C(\C)CCC=C(C)C)c(OC(=O)CCN2CCOCC2/C(=C/C(=O)O)C(=O)O)c1 |
| InChI | InChI=1S/C33H47NO8/c1-6-7-8-12-25-19-29(40-5)26(14-13-24(4)11-9-10-23(2)3)30(20-25)42-32(37)15-16-34-17-18-41-22-28(34)27(33(38)39)21-31(35)36/h10,13,19-21,28H,6-9,11-12,14-18,22H2,1-5H3,(H,35,36)(H,38,39)/b24-13+,27-21- |
| InChIKey | MNLNKQQTHYHOIY-FVTKGJGMSA-N |
| XLogP | 5.76 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.74 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|