C22H40N2 — CID 72671729
3,7,11-trimethyl-N-(3-pyrrolidin-1-ylpropyl)dodeca-2,6,10-trien-1-amine (PubChem CID 72671729) has the molecular formula C22H40N2 and a molecular weight of 332.58 g/mol. Its IUPAC name is 3,7,11-trimethyl-N-(3-pyrrolidin-1-ylpropyl)dodeca-2,6,10-trien-1-amine.
| Compound Name | 3,7,11-trimethyl-N-(3-pyrrolidin-1-ylpropyl)dodeca-2,6,10-trien-1-amine |
|---|---|
| PubChem CID | 72671729 |
| Molecular Formula | C22H40N2 |
| Molecular Weight | 332.58 g/mol |
| Exact Mass | 332.32 |
| IUPAC Name | 3,7,11-trimethyl-N-(3-pyrrolidin-1-ylpropyl)dodeca-2,6,10-trien-1-amine |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCNCCCN1CCCC1 |
| InChI | InChI=1S/C22H40N2/c1-20(2)10-7-11-21(3)12-8-13-22(4)14-16-23-15-9-19-24-17-5-6-18-24/h10,12,14,23H,5-9,11,13,15-19H2,1-4H3 |
| InChIKey | PEWBZCRSCVXWEW-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.58 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|