C18H34N2 — CID 39820519
N-[(2E)-3,7-dimethylocta-2,6-dienyl]-1-propylpiperidin-4-amine (PubChem CID 39820519) has the molecular formula C18H34N2 and a molecular weight of 278.48 g/mol. Its IUPAC name is N-[(2E)-3,7-dimethylocta-2,6-dienyl]-1-propylpiperidin-4-amine.
| Compound Name | N-[(2E)-3,7-dimethylocta-2,6-dienyl]-1-propylpiperidin-4-amine |
|---|---|
| PubChem CID | 39820519 |
| Molecular Formula | C18H34N2 |
| Molecular Weight | 278.48 g/mol |
| Exact Mass | 278.27 |
| IUPAC Name | N-[(2E)-3,7-dimethylocta-2,6-dienyl]-1-propylpiperidin-4-amine |
| SMILES | CCCN1CCC(NC/C=C(\C)CCC=C(C)C)CC1 |
| InChI | InChI=1S/C18H34N2/c1-5-13-20-14-10-18(11-15-20)19-12-9-17(4)8-6-7-16(2)3/h7,9,18-19H,5-6,8,10-15H2,1-4H3/b17-9+ |
| InChIKey | WWUIFXOEOGMQKZ-RQZCQDPDSA-N |
| XLogP | 4.14 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.48 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|